C24H32FN4O2+3 — CID 7291800
3-(4-benzylpiperazine-1,4-diium-1-yl)propyl-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7291800) has the molecular formula C24H32FN4O2+3 and a molecular weight of 427.54 g/mol. Its IUPAC name is 3-(4-benzylpiperazine-1,4-diium-1-yl)propyl-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | 3-(4-benzylpiperazine-1,4-diium-1-yl)propyl-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7291800 |
| Molecular Formula | C24H32FN4O2+3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-(4-benzylpiperazine-1,4-diium-1-yl)propyl-[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | O=C1C[C@@H]([NH2+]CCC[NH+]2CC[NH+](Cc3ccccc3)CC2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FN4O2/c25-20-7-9-21(10-8-20)29-23(30)17-22(24(29)31)26-11-4-12-27-13-15-28(16-14-27)18-19-5-2-1-3-6-19/h1-3,5-10,22,26H,4,11-18H2/p+3/t22-/m1/s1 |
| InChIKey | WBVZISLTLRUMSO-JOCHJYFZSA-Q |
| XLogP | -1.61 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|