C17H18N3O3+ — CID 4168854
[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(pyridin-3-ylmethyl)azanium (PubChem CID 4168854) has the molecular formula C17H18N3O3+ and a molecular weight of 312.35 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(pyridin-3-ylmethyl)azanium.
| Compound Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 4168854 |
| Molecular Formula | C17H18N3O3+ |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-(pyridin-3-ylmethyl)azanium |
| SMILES | COc1ccc(N2C(=O)CC([NH2+]Cc3cccnc3)C2=O)cc1 |
| InChI | InChI=1S/C17H17N3O3/c1-23-14-6-4-13(5-7-14)20-16(21)9-15(17(20)22)19-11-12-3-2-8-18-10-12/h2-8,10,15,19H,9,11H2,1H3/p+1 |
| InChIKey | HAPKFEUZHHWAHL-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|