C24H31N2O3+ — CID 7329798
benzyl-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium (PubChem CID 7329798) has the molecular formula C24H31N2O3+ and a molecular weight of 395.52 g/mol. Its IUPAC name is benzyl-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium.
| Compound Name | benzyl-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium |
|---|---|
| PubChem CID | 7329798 |
| Molecular Formula | C24H31N2O3+ |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | benzyl-[(3S)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium |
| SMILES | CCCCCCOc1ccc(N2C(=O)C[C@H]([NH+](C)Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-4-5-9-16-29-21-14-12-20(13-15-21)26-23(27)17-22(24(26)28)25(2)18-19-10-7-6-8-11-19/h6-8,10-15,22H,3-5,9,16-18H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | XCSZWJQIASJREB-QFIPXVFZSA-O |
| XLogP | 2.99 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|