C24H23N2O2+ — CID 7434882
dibenzyl-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]azanium (PubChem CID 7434882) has the molecular formula C24H23N2O2+ and a molecular weight of 371.46 g/mol. Its IUPAC name is dibenzyl-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]azanium.
| Compound Name | dibenzyl-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7434882 |
| Molecular Formula | C24H23N2O2+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | dibenzyl-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]azanium |
| SMILES | O=C1C[C@@H]([NH+](Cc2ccccc2)Cc2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c27-23-16-22(24(28)26(23)21-14-8-3-9-15-21)25(17-19-10-4-1-5-11-19)18-20-12-6-2-7-13-20/h1-15,22H,16-18H2/p+1/t22-/m1/s1 |
| InChIKey | FXUYFNRCKOFAMO-JOCHJYFZSA-O |
| XLogP | 2.60 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|