C18H18IN2O2+ — CID 3488716
benzyl-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium (PubChem CID 3488716) has the molecular formula C18H18IN2O2+ and a molecular weight of 421.26 g/mol. Its IUPAC name is benzyl-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium.
| Compound Name | benzyl-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium |
|---|---|
| PubChem CID | 3488716 |
| Molecular Formula | C18H18IN2O2+ |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | benzyl-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-methylazanium |
| SMILES | C[NH+](Cc1ccccc1)C1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C18H17IN2O2/c1-20(12-13-5-3-2-4-6-13)16-11-17(22)21(18(16)23)15-9-7-14(19)8-10-15/h2-10,16H,11-12H2,1H3/p+1 |
| InChIKey | UXYHRWKZHDJGPW-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|