C20H23N4O2+ — CID 7303462
[(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]-diethylazanium (PubChem CID 7303462) has the molecular formula C20H23N4O2+ and a molecular weight of 351.43 g/mol. Its IUPAC name is [(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]-diethylazanium.
| Compound Name | [(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]-diethylazanium |
|---|---|
| PubChem CID | 7303462 |
| Molecular Formula | C20H23N4O2+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [(3R)-2,5-dioxo-1-(4-phenyldiazenylphenyl)pyrrolidin-3-yl]-diethylazanium |
| SMILES | CC[NH+](CC)[C@@H]1CC(=O)N(c2ccc(/N=N/c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C20H22N4O2/c1-3-23(4-2)18-14-19(25)24(20(18)26)17-12-10-16(11-13-17)22-21-15-8-6-5-7-9-15/h5-13,18H,3-4,14H2,1-2H3/p+1/b22-21+/t18-/m1/s1 |
| InChIKey | FKOKZSGGFPYTAY-KHOFPDMRSA-O |
| XLogP | 2.66 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|