C16H23N2O2+ — CID 6947342
[(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-diethylazanium (PubChem CID 6947342) has the molecular formula C16H23N2O2+ and a molecular weight of 275.37 g/mol. Its IUPAC name is [(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-diethylazanium.
| Compound Name | [(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-diethylazanium |
|---|---|
| PubChem CID | 6947342 |
| Molecular Formula | C16H23N2O2+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | [(3R)-1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]-diethylazanium |
| SMILES | CC[NH+](CC)[C@@H]1CC(=O)N(c2c(C)cccc2C)C1=O |
| InChI | InChI=1S/C16H22N2O2/c1-5-17(6-2)13-10-14(19)18(16(13)20)15-11(3)8-7-9-12(15)4/h7-9,13H,5-6,10H2,1-4H3/p+1/t13-/m1/s1 |
| InChIKey | BOPREVQCNLHSHR-CYBMUJFWSA-O |
| XLogP | 0.86 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|