C20H29N2O4+ — CID 7323110
[(3S)-1-[4-(2-butoxy-2-oxoethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-diethylazanium (PubChem CID 7323110) has the molecular formula C20H29N2O4+ and a molecular weight of 361.46 g/mol. Its IUPAC name is [(3S)-1-[4-(2-butoxy-2-oxoethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-diethylazanium.
| Compound Name | [(3S)-1-[4-(2-butoxy-2-oxoethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-diethylazanium |
|---|---|
| PubChem CID | 7323110 |
| Molecular Formula | C20H29N2O4+ |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | [(3S)-1-[4-(2-butoxy-2-oxoethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-diethylazanium |
| SMILES | CCCCOC(=O)Cc1ccc(N2C(=O)C[C@H]([NH+](CC)CC)C2=O)cc1 |
| InChI | InChI=1S/C20H28N2O4/c1-4-7-12-26-19(24)13-15-8-10-16(11-9-15)22-18(23)14-17(20(22)25)21(5-2)6-3/h8-11,17H,4-7,12-14H2,1-3H3/p+1/t17-/m0/s1 |
| InChIKey | RDPHRQFAYOXMLY-KRWDZBQOSA-O |
| XLogP | 1.13 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|