C22H22IN3O2S2 — CID 99129799
[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate (PubChem CID 99129799) has the molecular formula C22H22IN3O2S2 and a molecular weight of 551.48 g/mol. Its IUPAC name is [(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate.
| Compound Name | [(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 99129799 |
| Molecular Formula | C22H22IN3O2S2 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | [(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] 4-benzylpiperazine-1-carbodithioate |
| SMILES | O=C1C[C@H](SC(=S)N2CCN(Cc3ccccc3)CC2)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C22H22IN3O2S2/c23-17-6-8-18(9-7-17)26-20(27)14-19(21(26)28)30-22(29)25-12-10-24(11-13-25)15-16-4-2-1-3-5-16/h1-9,19H,10-15H2/t19-/m0/s1 |
| InChIKey | JJLQNVKMGIRBPQ-IBGZPJMESA-N |
| XLogP | 3.76 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|