C18H13IN4O2S — CID 23102127
[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate (PubChem CID 23102127) has the molecular formula C18H13IN4O2S and a molecular weight of 476.30 g/mol. Its IUPAC name is [1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate.
| Compound Name | [1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 23102127 |
| Molecular Formula | C18H13IN4O2S |
| Molecular Weight | 476.30 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | [1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate |
| SMILES | N#CN/C(=N\c1ccccc1)SC1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C18H13IN4O2S/c19-12-6-8-14(9-7-12)23-16(24)10-15(17(23)25)26-18(21-11-20)22-13-4-2-1-3-5-13/h1-9,15H,10H2,(H,21,22) |
| InChIKey | XTEVCSHWOKOLFC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|