C20H18N4O2S — CID 99129024
[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate (PubChem CID 99129024) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is [(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate.
| Compound Name | [(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 99129024 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] N-cyano-N'-phenylcarbamimidothioate |
| SMILES | Cc1ccc(N2C(=O)C[C@H](S/C(=N/c3ccccc3)NC#N)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H18N4O2S/c1-13-8-9-16(14(2)10-13)24-18(25)11-17(19(24)26)27-20(22-12-21)23-15-6-4-3-5-7-15/h3-10,17H,11H2,1-2H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | YIASWORGHZNMSU-KRWDZBQOSA-N |
| XLogP | 3.43 |
| TPSA | 85.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|