C18H12ClIN4O2S — CID 23102343
[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(2-chlorophenyl)-N-cyanocarbamimidothioate (PubChem CID 23102343) has the molecular formula C18H12ClIN4O2S and a molecular weight of 510.74 g/mol. Its IUPAC name is [1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(2-chlorophenyl)-N-cyanocarbamimidothioate.
| Compound Name | [1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(2-chlorophenyl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 23102343 |
| Molecular Formula | C18H12ClIN4O2S |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 509.94 |
| IUPAC Name | [1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(2-chlorophenyl)-N-cyanocarbamimidothioate |
| SMILES | N#CN/C(=N/c1ccccc1Cl)SC1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C18H12ClIN4O2S/c19-13-3-1-2-4-14(13)23-18(22-10-21)27-15-9-16(25)24(17(15)26)12-7-5-11(20)6-8-12/h1-8,15H,9H2,(H,22,23) |
| InChIKey | AWKGRODFBPUCRJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|