C15H19N3O2S — CID 2833588
(2,5-dioxo-1-phenylpyrrolidin-3-yl) N,N'-diethylcarbamimidothioate (PubChem CID 2833588) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is (2,5-dioxo-1-phenylpyrrolidin-3-yl) N,N'-diethylcarbamimidothioate.
| Compound Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) N,N'-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 2833588 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) N,N'-diethylcarbamimidothioate |
| SMILES | CC/N=C(\NCC)SC1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H19N3O2S/c1-3-16-15(17-4-2)21-12-10-13(19)18(14(12)20)11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3,(H,16,17) |
| InChIKey | DKBZJNNWRKMSPV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|