C10H17N3O2S — CID 5338468
(1-methyl-2,5-dioxopyrrolidin-3-yl) N,N'-diethylcarbamimidothioate (PubChem CID 5338468) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is (1-methyl-2,5-dioxopyrrolidin-3-yl) N,N'-diethylcarbamimidothioate.
| Compound Name | (1-methyl-2,5-dioxopyrrolidin-3-yl) N,N'-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 5338468 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (1-methyl-2,5-dioxopyrrolidin-3-yl) N,N'-diethylcarbamimidothioate |
| SMILES | CC/N=C(\NCC)SC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C10H17N3O2S/c1-4-11-10(12-5-2)16-7-6-8(14)13(3)9(7)15/h7H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | WYVLFFWCDPLASD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|