C20H19BrClN3O2S — CID 6342804
[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chloro-4-methylphenyl)-N'-ethylcarbamimidothioate (PubChem CID 6342804) has the molecular formula C20H19BrClN3O2S and a molecular weight of 480.82 g/mol. Its IUPAC name is [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chloro-4-methylphenyl)-N'-ethylcarbamimidothioate.
| Compound Name | [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chloro-4-methylphenyl)-N'-ethylcarbamimidothioate |
|---|---|
| PubChem CID | 6342804 |
| Molecular Formula | C20H19BrClN3O2S |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | [(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chloro-4-methylphenyl)-N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(/Nc1ccc(C)c(Cl)c1)S[C@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C20H19BrClN3O2S/c1-3-23-20(24-14-7-4-12(2)16(22)10-14)28-17-11-18(26)25(19(17)27)15-8-5-13(21)6-9-15/h4-10,17H,3,11H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | DNNXPKMMPDAJBR-KRWDZBQOSA-N |
| XLogP | 5.26 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|