C20H18FN3O4S — CID 34361386
4-[(3R)-3-[N'-ethyl-N-(3-fluorophenyl)carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 34361386) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[(3R)-3-[N'-ethyl-N-(3-fluorophenyl)carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[(3R)-3-[N'-ethyl-N-(3-fluorophenyl)carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 34361386 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-[(3R)-3-[N'-ethyl-N-(3-fluorophenyl)carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | CC/N=C(\Nc1cccc(F)c1)S[C@@H]1CC(=O)N(c2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C20H18FN3O4S/c1-2-22-20(23-14-5-3-4-13(21)10-14)29-16-11-17(25)24(18(16)26)15-8-6-12(7-9-15)19(27)28/h3-10,16H,2,11H2,1H3,(H,22,23)(H,27,28)/t16-/m1/s1 |
| InChIKey | HLZMIUUSXSJTPR-MRXNPFEDSA-N |
| XLogP | 3.38 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|