C18H15F2N3O2S — CID 6342195
[(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-fluorophenyl)-N'-methylcarbamimidothioate (PubChem CID 6342195) has the molecular formula C18H15F2N3O2S and a molecular weight of 375.40 g/mol. Its IUPAC name is [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-fluorophenyl)-N'-methylcarbamimidothioate.
| Compound Name | [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-fluorophenyl)-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 6342195 |
| Molecular Formula | C18H15F2N3O2S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [(3S)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-fluorophenyl)-N'-methylcarbamimidothioate |
| SMILES | C/N=C(\Nc1cccc(F)c1)S[C@H]1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H15F2N3O2S/c1-21-18(22-13-4-2-3-12(20)9-13)26-15-10-16(24)23(17(15)25)14-7-5-11(19)6-8-14/h2-9,15H,10H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | IATKCDMBPOUTNC-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|