C19H17ClFN3O2S — CID 7346028
[(3R)-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate (PubChem CID 7346028) has the molecular formula C19H17ClFN3O2S and a molecular weight of 405.88 g/mol. Its IUPAC name is [(3R)-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate.
| Compound Name | [(3R)-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 7346028 |
| Molecular Formula | C19H17ClFN3O2S |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | [(3R)-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate |
| SMILES | C/N=C(\Nc1ccc(F)cc1)S[C@@H]1CC(=O)N(c2ccc(C)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H17ClFN3O2S/c1-11-3-8-14(9-15(11)20)24-17(25)10-16(18(24)26)27-19(22-2)23-13-6-4-12(21)5-7-13/h3-9,16H,10H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | VPTUYGWXESQKQX-MRXNPFEDSA-N |
| XLogP | 4.25 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|