C19H13Cl3F3N3O2S — CID 3402748
[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methylcarbamimidothioate (PubChem CID 3402748) has the molecular formula C19H13Cl3F3N3O2S and a molecular weight of 510.75 g/mol. Its IUPAC name is [1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methylcarbamimidothioate.
| Compound Name | [1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 3402748 |
| Molecular Formula | C19H13Cl3F3N3O2S |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | [1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-methylcarbamimidothioate |
| SMILES | C/N=C(/Nc1ccc(Cl)c(C(F)(F)F)c1)SC1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C19H13Cl3F3N3O2S/c1-26-18(27-11-2-3-14(22)13(7-11)19(23,24)25)31-15-8-16(29)28(17(15)30)12-5-9(20)4-10(21)6-12/h2-7,15H,8H2,1H3,(H,26,27) |
| InChIKey | IECQBKJOQHKDIF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|