C19H16FN3O4S — CID 6343158
[(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate (PubChem CID 6343158) has the molecular formula C19H16FN3O4S and a molecular weight of 401.42 g/mol. Its IUPAC name is [(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate.
| Compound Name | [(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 6343158 |
| Molecular Formula | C19H16FN3O4S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [(3S)-1-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(1,3-benzodioxol-5-yl)-N'-methylcarbamimidothioate |
| SMILES | C/N=C(/Nc1ccc2c(c1)OCO2)S[C@H]1CC(=O)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C19H16FN3O4S/c1-21-19(22-11-6-7-14-15(8-11)27-10-26-14)28-16-9-17(24)23(18(16)25)13-5-3-2-4-12(13)20/h2-8,16H,9-10H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | TUBZRCPPYDCATH-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|