C27H23N3O6S — CID 3880582
methyl 4-[3-[N'-(1,3-benzodioxol-5-ylmethyl)-N-phenylcarbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 3880582) has the molecular formula C27H23N3O6S and a molecular weight of 517.56 g/mol. Its IUPAC name is methyl 4-[3-[N'-(1,3-benzodioxol-5-ylmethyl)-N-phenylcarbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[N'-(1,3-benzodioxol-5-ylmethyl)-N-phenylcarbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 3880582 |
| Molecular Formula | C27H23N3O6S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | methyl 4-[3-[N'-(1,3-benzodioxol-5-ylmethyl)-N-phenylcarbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(S/C(=N\Cc3ccc4c(c3)OCO4)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H23N3O6S/c1-34-26(33)18-8-10-20(11-9-18)30-24(31)14-23(25(30)32)37-27(29-19-5-3-2-4-6-19)28-15-17-7-12-21-22(13-17)36-16-35-21/h2-13,23H,14-16H2,1H3,(H,28,29) |
| InChIKey | NVWLPXHCSVXIOW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|