C20H18N3O4S- — CID 7783107
4-[(3S)-3-(N'-ethyl-N-phenylcarbamimidoyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 7783107) has the molecular formula C20H18N3O4S- and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-[(3S)-3-(N'-ethyl-N-phenylcarbamimidoyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | 4-[(3S)-3-(N'-ethyl-N-phenylcarbamimidoyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 7783107 |
| Molecular Formula | C20H18N3O4S- |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 4-[(3S)-3-(N'-ethyl-N-phenylcarbamimidoyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CC/N=C(\Nc1ccccc1)S[C@H]1CC(=O)N(c2ccc(C(=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C20H19N3O4S/c1-2-21-20(22-14-6-4-3-5-7-14)28-16-12-17(24)23(18(16)25)15-10-8-13(9-11-15)19(26)27/h3-11,16H,2,12H2,1H3,(H,21,22)(H,26,27)/p-1/t16-/m0/s1 |
| InChIKey | YUBGAOXCNWKCOC-INIZCTEOSA-M |
| XLogP | 1.90 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|