C14H11ClF3NO4S — CID 43860519
3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 43860519) has the molecular formula C14H11ClF3NO4S and a molecular weight of 381.76 g/mol. Its IUPAC name is 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43860519 |
| Molecular Formula | C14H11ClF3NO4S |
| Molecular Weight | 381.76 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC1CC(=O)N(c2ccc(Cl)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C14H11ClF3NO4S/c15-9-2-1-7(5-8(9)14(16,17)18)19-11(20)6-10(13(19)23)24-4-3-12(21)22/h1-2,5,10H,3-4,6H2,(H,21,22) |
| InChIKey | ZWJRCFOYVRJKGK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|