C16H19NO4S — CID 43826968
3-[2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 43826968) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-[2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 3-[2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43826968 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-[2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | Cc1cc(C)c(N2C(=O)CC(SCCC(=O)O)C2=O)c(C)c1 |
| InChI | InChI=1S/C16H19NO4S/c1-9-6-10(2)15(11(3)7-9)17-13(18)8-12(16(17)21)22-5-4-14(19)20/h6-7,12H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | UJTLHVNUGPJNJX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|