C15H15ClF3N3O2 — CID 54773614
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperazin-1-ylpyrrolidine-2,5-dione (PubChem CID 54773614) has the molecular formula C15H15ClF3N3O2 and a molecular weight of 361.75 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperazin-1-ylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperazin-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54773614 |
| Molecular Formula | C15H15ClF3N3O2 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-piperazin-1-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCNCC2)C(=O)N1c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15ClF3N3O2/c16-11-2-1-9(7-10(11)15(17,18)19)22-13(23)8-12(14(22)24)21-5-3-20-4-6-21/h1-2,7,12,20H,3-6,8H2 |
| InChIKey | FURQFAKQCLVPAM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|