C19H20ClF3N2O4 — CID 29158058
ethyl 1-[(3S)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate (PubChem CID 29158058) has the molecular formula C19H20ClF3N2O4 and a molecular weight of 432.83 g/mol. Its IUPAC name is ethyl 1-[(3S)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(3S)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 29158058 |
| Molecular Formula | C19H20ClF3N2O4 |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | ethyl 1-[(3S)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN([C@H]2CC(=O)N(c3ccc(Cl)c(C(F)(F)F)c3)C2=O)CC1 |
| InChI | InChI=1S/C19H20ClF3N2O4/c1-2-29-18(28)11-5-7-24(8-6-11)15-10-16(26)25(17(15)27)12-3-4-14(20)13(9-12)19(21,22)23/h3-4,9,11,15H,2,5-8,10H2,1H3/t15-/m0/s1 |
| InChIKey | UNSCKEWYCWEMFD-HNNXBMFYSA-N |
| XLogP | 3.27 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|