C22H26N2O8 — CID 29101446
dimethyl 5-[(3S)-3-(4-ethoxycarbonylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate (PubChem CID 29101446) has the molecular formula C22H26N2O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is dimethyl 5-[(3S)-3-(4-ethoxycarbonylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(3S)-3-(4-ethoxycarbonylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 29101446 |
| Molecular Formula | C22H26N2O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | dimethyl 5-[(3S)-3-(4-ethoxycarbonylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CCN([C@H]2CC(=O)N(c3cc(C(=O)OC)cc(C(=O)OC)c3)C2=O)CC1 |
| InChI | InChI=1S/C22H26N2O8/c1-4-32-22(29)13-5-7-23(8-6-13)17-12-18(25)24(19(17)26)16-10-14(20(27)30-2)9-15(11-16)21(28)31-3/h9-11,13,17H,4-8,12H2,1-3H3/t17-/m0/s1 |
| InChIKey | COWKZIPAMUPNCH-KRWDZBQOSA-N |
| XLogP | 1.17 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|