C20H24N2O6 — CID 17228689
ethyl 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate (PubChem CID 17228689) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 17228689 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | ethyl 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2CC(=O)N(c3ccc4c(c3)OCCO4)C2=O)CC1 |
| InChI | InChI=1S/C20H24N2O6/c1-2-26-20(25)13-5-7-21(8-6-13)15-12-18(23)22(19(15)24)14-3-4-16-17(11-14)28-10-9-27-16/h3-4,11,13,15H,2,5-10,12H2,1H3 |
| InChIKey | QNBZJFBNKPCOIM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|