C18H20Cl2N2O4 — CID 92698727
ethyl 1-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate (PubChem CID 92698727) has the molecular formula C18H20Cl2N2O4 and a molecular weight of 399.27 g/mol. Its IUPAC name is ethyl 1-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 92698727 |
| Molecular Formula | C18H20Cl2N2O4 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | ethyl 1-[(3R)-1-(2,3-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN([C@@H]2CC(=O)N(c3cccc(Cl)c3Cl)C2=O)CC1 |
| InChI | InChI=1S/C18H20Cl2N2O4/c1-2-26-18(25)11-6-8-21(9-7-11)14-10-15(23)22(17(14)24)13-5-3-4-12(19)16(13)20/h3-5,11,14H,2,6-10H2,1H3/t14-/m1/s1 |
| InChIKey | OJGMLHHMKWWIRJ-CQSZACIVSA-N |
| XLogP | 2.90 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|