C14H16FN3O2 — CID 54773613
1-(3-fluorophenyl)-3-piperazin-1-ylpyrrolidine-2,5-dione (PubChem CID 54773613) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-piperazin-1-ylpyrrolidine-2,5-dione.
| Compound Name | 1-(3-fluorophenyl)-3-piperazin-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54773613 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-piperazin-1-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCNCC2)C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C14H16FN3O2/c15-10-2-1-3-11(8-10)18-13(19)9-12(14(18)20)17-6-4-16-5-7-17/h1-3,8,12,16H,4-7,9H2 |
| InChIKey | PMEQDEDUCIJGJB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|