C15H14Cl2N2O5S — CID 51568653
(2R)-2-acetamido-3-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 51568653) has the molecular formula C15H14Cl2N2O5S and a molecular weight of 405.26 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 51568653 |
| Molecular Formula | C15H14Cl2N2O5S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | (2R)-2-acetamido-3-[(3R)-1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CS[C@@H]1CC(=O)N(c2ccc(Cl)c(Cl)c2)C1=O)C(=O)O |
| InChI | InChI=1S/C15H14Cl2N2O5S/c1-7(20)18-11(15(23)24)6-25-12-5-13(21)19(14(12)22)8-2-3-9(16)10(17)4-8/h2-4,11-12H,5-6H2,1H3,(H,18,20)(H,23,24)/t11-,12+/m0/s1 |
| InChIKey | PHLKUYMHOWGHRU-NWDGAFQWSA-N |
| XLogP | 1.95 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|