C17H20N2O5S — CID 27404742
(2S)-2-acetamido-3-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 27404742) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | (2S)-2-acetamido-3-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 27404742 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2S)-2-acetamido-3-[(3R)-1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@H](CS[C@@H]1CC(=O)N(c2ccc(C)c(C)c2)C1=O)C(=O)O |
| InChI | InChI=1S/C17H20N2O5S/c1-9-4-5-12(6-10(9)2)19-15(21)7-14(16(19)22)25-8-13(17(23)24)18-11(3)20/h4-6,13-14H,7-8H2,1-3H3,(H,18,20)(H,23,24)/t13-,14-/m1/s1 |
| InChIKey | CSFKFVCTXAETKD-ZIAGYGMSSA-N |
| XLogP | 1.26 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|