C13H14IN3O2S — CID 6343143
[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N,N'-dimethylcarbamimidothioate (PubChem CID 6343143) has the molecular formula C13H14IN3O2S and a molecular weight of 403.25 g/mol. Its IUPAC name is [(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N,N'-dimethylcarbamimidothioate.
| Compound Name | [(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 6343143 |
| Molecular Formula | C13H14IN3O2S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | [(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl] N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)S[C@H]1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C13H14IN3O2S/c1-15-13(16-2)20-10-7-11(18)17(12(10)19)9-5-3-8(14)4-6-9/h3-6,10H,7H2,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | FOFJNAKKMSFVBN-JTQLQIEISA-N |
| XLogP | 1.86 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|