C8H15NO2S2 — CID 176950350
ethane;1-methyl-3-(methyldisulfanyl)pyrrolidine-2,5-dione (PubChem CID 176950350) has the molecular formula C8H15NO2S2 and a molecular weight of 221.35 g/mol. Its IUPAC name is ethane;1-methyl-3-(methyldisulfanyl)pyrrolidine-2,5-dione.
| Compound Name | ethane;1-methyl-3-(methyldisulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 176950350 |
| Molecular Formula | C8H15NO2S2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | ethane;1-methyl-3-(methyldisulfanyl)pyrrolidine-2,5-dione |
| SMILES | CC.CSSC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H9NO2S2.C2H6/c1-7-5(8)3-4(6(7)9)11-10-2;1-2/h4H,3H2,1-2H3;1-2H3 |
| InChIKey | PXILUGBWGOHECV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|