C5H6HgNO2 — CID 142151473
(1-methyl-2,5-dioxopyrrolidin-3-yl)mercury (PubChem CID 142151473) has the molecular formula C5H6HgNO2 and a molecular weight of 312.70 g/mol. Its IUPAC name is (1-methyl-2,5-dioxopyrrolidin-3-yl)mercury.
| Compound Name | (1-methyl-2,5-dioxopyrrolidin-3-yl)mercury |
|---|---|
| PubChem CID | 142151473 |
| Molecular Formula | C5H6HgNO2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | (1-methyl-2,5-dioxopyrrolidin-3-yl)mercury |
| SMILES | CN1C(=O)CC([Hg])C1=O |
| InChI | InChI=1S/C5H6NO2.Hg/c1-6-4(7)2-3-5(6)8;/h2H,3H2,1H3; |
| InChIKey | RCDQDUWLEUJSGO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|