About 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile
1-methyl-2,5-dioxopyrrolidine-3-carbonitrile (PubChem CID 83815093) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile.
Molecular Properties
| Compound Name | 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile |
| PubChem CID | 83815093 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile |
| SMILES | CN1C(=O)CC(C#N)C1=O |
| InChI | InChI=1S/C6H6N2O2/c1-8-5(9)2-4(3-7)6(8)10/h4H,2H2,1H3 |
| InChIKey | RYIFATINKGTPAW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile?
The IUPAC name of 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile (CID 83815093) is 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile.
What is the SMILES notation for 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile?
The canonical SMILES for 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile is CN1C(=O)CC(C#N)C1=O.
What is the InChIKey of 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile?
The InChIKey is RYIFATINKGTPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c1-8-5(9)2-4(3-7)6(8)10/h4H,2H2,1H3.
What are the key properties of 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile?
1-methyl-2,5-dioxopyrrolidine-3-carbonitrile has a molecular weight of 138.13 g/mol, XLogP of -0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile is sourced from PubChem (CID 83815093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).