C6H6N2O2 — CID 83815093
1-methyl-2,5-dioxopyrrolidine-3-carbonitrile (PubChem CID 83815093) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile.
| Compound Name | 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 83815093 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 1-methyl-2,5-dioxopyrrolidine-3-carbonitrile |
| SMILES | CN1C(=O)CC(C#N)C1=O |
| InChI | InChI=1S/C6H6N2O2/c1-8-5(9)2-4(3-7)6(8)10/h4H,2H2,1H3 |
| InChIKey | RYIFATINKGTPAW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|