About 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione
3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione (PubChem CID 3050266) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione |
| PubChem CID | 3050266 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione |
| SMILES | COc1cc(OC)cc(C2CC(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C13H15NO4/c1-14-12(15)7-11(13(14)16)8-4-9(17-2)6-10(5-8)18-3/h4-6,11H,7H2,1-3H3 |
| InChIKey | FNHGARBWPDUGJY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione?
The IUPAC name of 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione (CID 3050266) is 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione.
What is the SMILES notation for 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione?
The canonical SMILES for 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione is COc1cc(OC)cc(C2CC(=O)N(C)C2=O)c1.
What is the InChIKey of 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione?
The InChIKey is FNHGARBWPDUGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-14-12(15)7-11(13(14)16)8-4-9(17-2)6-10(5-8)18-3/h4-6,11H,7H2,1-3H3.
What are the key properties of 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione?
3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione has a molecular weight of 249.27 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethoxyphenyl)-1-methylpyrrolidine-2,5-dione is sourced from PubChem (CID 3050266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).