C12H14N2O3S — CID 79518822
3-(2-amino-5-methoxyphenyl)sulfanyl-1-methylpyrrolidine-2,5-dione (PubChem CID 79518822) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-(2-amino-5-methoxyphenyl)sulfanyl-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(2-amino-5-methoxyphenyl)sulfanyl-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79518822 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-(2-amino-5-methoxyphenyl)sulfanyl-1-methylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(N)c(SC2CC(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C12H14N2O3S/c1-14-11(15)6-10(12(14)16)18-9-5-7(17-2)3-4-8(9)13/h3-5,10H,6,13H2,1-2H3 |
| InChIKey | PBJMAXMUDRJTKR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|