C22H22N2O7S — CID 18893692
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate (PubChem CID 18893692) has the molecular formula C22H22N2O7S and a molecular weight of 458.49 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate |
|---|---|
| PubChem CID | 18893692 |
| Molecular Formula | C22H22N2O7S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccccc2SC2CC(=O)N(C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O7S/c1-24-20(26)11-18(21(24)27)32-17-7-5-4-6-14(17)22(28)31-12-19(25)23-15-9-8-13(29-2)10-16(15)30-3/h4-10,18H,11-12H2,1-3H3,(H,23,25) |
| InChIKey | DDPNQHNWIDGXSI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|