C21H17F3N2O5S — CID 18893657
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate (PubChem CID 18893657) has the molecular formula C21H17F3N2O5S and a molecular weight of 466.44 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate |
|---|---|
| PubChem CID | 18893657 |
| Molecular Formula | C21H17F3N2O5S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate |
| SMILES | CN1C(=O)CC(Sc2ccccc2C(=O)OCC(=O)Nc2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C21H17F3N2O5S/c1-26-18(28)10-16(19(26)29)32-15-9-5-2-6-12(15)20(30)31-11-17(27)25-14-8-4-3-7-13(14)21(22,23)24/h2-9,16H,10-11H2,1H3,(H,25,27) |
| InChIKey | DJMTVBLBQAYDMS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|