C20H16Cl2N2O5S — CID 18893671
[2-(2,5-dichloroanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate (PubChem CID 18893671) has the molecular formula C20H16Cl2N2O5S and a molecular weight of 467.33 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate |
|---|---|
| PubChem CID | 18893671 |
| Molecular Formula | C20H16Cl2N2O5S |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoate |
| SMILES | CN1C(=O)CC(Sc2ccccc2C(=O)OCC(=O)Nc2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C20H16Cl2N2O5S/c1-24-18(26)9-16(19(24)27)30-15-5-3-2-4-12(15)20(28)29-10-17(25)23-14-8-11(21)6-7-13(14)22/h2-8,16H,9-10H2,1H3,(H,23,25) |
| InChIKey | XUVXEEZTBXLLHP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|