C20H16ClN3O7S — CID 18893783
4-chloro-3-[[2-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carbonyl]oxyacetyl]amino]benzoic acid (PubChem CID 18893783) has the molecular formula C20H16ClN3O7S and a molecular weight of 477.88 g/mol. Its IUPAC name is 4-chloro-3-[[2-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carbonyl]oxyacetyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carbonyl]oxyacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18893783 |
| Molecular Formula | C20H16ClN3O7S |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 4-chloro-3-[[2-[2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carbonyl]oxyacetyl]amino]benzoic acid |
| SMILES | CN1C(=O)CC(Sc2ncccc2C(=O)OCC(=O)Nc2cc(C(=O)O)ccc2Cl)C1=O |
| InChI | InChI=1S/C20H16ClN3O7S/c1-24-16(26)8-14(18(24)27)32-17-11(3-2-6-22-17)20(30)31-9-15(25)23-13-7-10(19(28)29)4-5-12(13)21/h2-7,14H,8-9H2,1H3,(H,23,25)(H,28,29) |
| InChIKey | YMWJKAAJGWQWQE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 142.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|