C17H14N2O5S2 — CID 18893648
(2-oxo-2-thiophen-2-ylethyl) 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carboxylate (PubChem CID 18893648) has the molecular formula C17H14N2O5S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carboxylate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 18893648 |
| Molecular Formula | C17H14N2O5S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 2-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanylpyridine-3-carboxylate |
| SMILES | CN1C(=O)CC(Sc2ncccc2C(=O)OCC(=O)c2cccs2)C1=O |
| InChI | InChI=1S/C17H14N2O5S2/c1-19-14(21)8-13(16(19)22)26-15-10(4-2-6-18-15)17(23)24-9-11(20)12-5-3-7-25-12/h2-7,13H,8-9H2,1H3 |
| InChIKey | GJUQTUZHCCQZDR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|