C5H6AgNO2S — CID 177217221
silver 1-methyl-2,5-dioxopyrrolidine-3-thiolate (PubChem CID 177217221) has the molecular formula C5H6AgNO2S and a molecular weight of 252.04 g/mol. Its IUPAC name is silver 1-methyl-2,5-dioxopyrrolidine-3-thiolate.
| Compound Name | silver 1-methyl-2,5-dioxopyrrolidine-3-thiolate |
|---|---|
| PubChem CID | 177217221 |
| Molecular Formula | C5H6AgNO2S |
| Molecular Weight | 252.04 g/mol |
| Exact Mass | 250.92 |
| IUPAC Name | silver 1-methyl-2,5-dioxopyrrolidine-3-thiolate |
| SMILES | CN1C(=O)CC([S-])C1=O.[Ag+] |
| InChI | InChI=1S/C5H7NO2S.Ag/c1-6-4(7)2-3(9)5(6)8;/h3,9H,2H2,1H3;/q;+1/p-1 |
| InChIKey | DPMZXODFLNVBGP-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.04 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|