C9H14N2O4 — CID 107358283
3-(3,4-dihydroxypyrrolidin-1-yl)-1-methylpyrrolidine-2,5-dione (PubChem CID 107358283) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidin-1-yl)-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 107358283 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(N2CC(O)C(O)C2)C1=O |
| InChI | InChI=1S/C9H14N2O4/c1-10-8(14)2-5(9(10)15)11-3-6(12)7(13)4-11/h5-7,12-13H,2-4H2,1H3 |
| InChIKey | DVRGGLWTUFXVSF-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|