C8H11NO3 — CID 156748607
1-methyl-3-(2-oxopropyl)pyrrolidine-2,5-dione (PubChem CID 156748607) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-methyl-3-(2-oxopropyl)pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-(2-oxopropyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 156748607 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-methyl-3-(2-oxopropyl)pyrrolidine-2,5-dione |
| SMILES | CC(=O)CC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C8H11NO3/c1-5(10)3-6-4-7(11)9(2)8(6)12/h6H,3-4H2,1-2H3 |
| InChIKey | BIELBVSAKMYHTF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|