C12H13NO4 — CID 57388544
3-[(2,4-dihydroxyphenyl)methyl]-1-methylpyrrolidine-2,5-dione (PubChem CID 57388544) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methyl]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(2,4-dihydroxyphenyl)methyl]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 57388544 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methyl]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C12H13NO4/c1-13-11(16)5-8(12(13)17)4-7-2-3-9(14)6-10(7)15/h2-3,6,8,14-15H,4-5H2,1H3 |
| InChIKey | WKJCOCXIEIQNOM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|