C7H7FO2 — CID 91883667
4-(fluoromethyl)benzene-1,3-diol (PubChem CID 91883667) has the molecular formula C7H7FO2 and a molecular weight of 142.13 g/mol. Its IUPAC name is 4-(fluoromethyl)benzene-1,3-diol.
| Compound Name | 4-(fluoromethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 91883667 |
| Molecular Formula | C7H7FO2 |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 4-(fluoromethyl)benzene-1,3-diol |
| SMILES | Oc1ccc(CF)c(O)c1 |
| InChI | InChI=1S/C7H7FO2/c8-4-5-1-2-6(9)3-7(5)10/h1-3,9-10H,4H2 |
| InChIKey | IKLMLRMPBAOJMD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |