C8H12ClNO2 — CID 50988720
4-(2-aminoethyl)benzene-1,3-diol;hydrochloride (PubChem CID 50988720) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,3-diol;hydrochloride.
| Compound Name | 4-(2-aminoethyl)benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 50988720 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,3-diol;hydrochloride |
| SMILES | Cl.NCCc1ccc(O)cc1O |
| InChI | InChI=1S/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)5-8(6)11;/h1-2,5,10-11H,3-4,9H2;1H |
| InChIKey | GBHIWVGWSZHYFR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |