C15H17NO2 — CID 174965062
4-[2-[2-(aminomethyl)phenyl]ethyl]benzene-1,3-diol (PubChem CID 174965062) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-[2-[2-(aminomethyl)phenyl]ethyl]benzene-1,3-diol.
| Compound Name | 4-[2-[2-(aminomethyl)phenyl]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 174965062 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-[2-[2-(aminomethyl)phenyl]ethyl]benzene-1,3-diol |
| SMILES | NCc1ccccc1CCc1ccc(O)cc1O |
| InChI | InChI=1S/C15H17NO2/c16-10-13-4-2-1-3-11(13)5-6-12-7-8-14(17)9-15(12)18/h1-4,7-9,17-18H,5-6,10,16H2 |
| InChIKey | YIORZXSFPQZIDL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |